C14H16BrFN4S — CID 111977505
1-[(4-bromo-2-fluorophenyl)methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111977505) has the molecular formula C14H16BrFN4S and a molecular weight of 371.28 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111977505 |
| Molecular Formula | C14H16BrFN4S |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ncc(C)s1)NCc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H16BrFN4S/c1-9-6-18-13(21-9)8-20-14(17-2)19-7-10-3-4-11(15)5-12(10)16/h3-6H,7-8H2,1-2H3,(H2,17,19,20) |
| InChIKey | GGWCUAOPSMLKDD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|