C17H24N4O3S — CID 111517939
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111517939) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111517939 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ncc(C)s1)NCc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C17H24N4O3S/c1-11-8-19-16(25-11)10-21-17(18-2)20-9-12-6-14(23-4)15(24-5)7-13(12)22-3/h6-8H,9-10H2,1-5H3,(H2,18,20,21) |
| InChIKey | MOAMHGVKFDSJRS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|