C16H21FN4OS — CID 111518641
1-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111518641) has the molecular formula C16H21FN4OS and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111518641 |
| Molecular Formula | C16H21FN4OS |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ncc(C)s1)NC(C)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C16H21FN4OS/c1-10-8-19-15(23-10)9-20-16(18-3)21-11(2)12-5-6-14(22-4)13(17)7-12/h5-8,11H,9H2,1-4H3,(H2,18,20,21) |
| InChIKey | WRZUMJXWKZHXLV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|