C18H26FIN4OS — CID 111518632
1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111518632) has the molecular formula C18H26FIN4OS and a molecular weight of 492.40 g/mol. Its IUPAC name is 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111518632 |
| Molecular Formula | C18H26FIN4OS |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NC(C)c2ccc(OC)c(F)c2)s1.I |
| InChI | InChI=1S/C18H25FN4OS.HI/c1-5-14-11-22-17(25-14)8-9-21-18(20-3)23-12(2)13-6-7-16(24-4)15(19)10-13;/h6-7,10-12H,5,8-9H2,1-4H3,(H2,20,21,23);1H |
| InChIKey | FLEGLRKFHBACSL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|