C17H23F2IN4S — CID 111532980
1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111532980) has the molecular formula C17H23F2IN4S and a molecular weight of 480.37 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111532980 |
| Molecular Formula | C17H23F2IN4S |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)ethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NCCc2c(F)cccc2F)s1.I |
| InChI | InChI=1S/C17H22F2N4S.HI/c1-3-12-11-23-16(24-12)8-10-22-17(20-2)21-9-7-13-14(18)5-4-6-15(13)19;/h4-6,11H,3,7-10H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | KSPFUMGRZWWQGB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|