C16H21BrFIN4S — CID 111532768
1-[(4-bromo-3-fluorophenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111532768) has the molecular formula C16H21BrFIN4S and a molecular weight of 527.25 g/mol. Its IUPAC name is 1-[(4-bromo-3-fluorophenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromo-3-fluorophenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111532768 |
| Molecular Formula | C16H21BrFIN4S |
| Molecular Weight | 527.25 g/mol |
| Exact Mass | 525.97 |
| IUPAC Name | 1-[(4-bromo-3-fluorophenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NCc2ccc(Br)c(F)c2)s1.I |
| InChI | InChI=1S/C16H20BrFN4S.HI/c1-3-12-10-21-15(23-12)6-7-20-16(19-2)22-9-11-4-5-13(17)14(18)8-11;/h4-5,8,10H,3,6-7,9H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | HTWZDWMWTBGCLG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|