C19H27FIN5OS — CID 111531090
N-[2-[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide (PubChem CID 111531090) has the molecular formula C19H27FIN5OS and a molecular weight of 519.43 g/mol. Its IUPAC name is N-[2-[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111531090 |
| Molecular Formula | C19H27FIN5OS |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | N-[2-[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NCCNC(=O)c2ccc(C)c(F)c2)s1.I |
| InChI | InChI=1S/C19H26FN5OS.HI/c1-4-15-12-25-17(27-15)7-8-23-19(21-3)24-10-9-22-18(26)14-6-5-13(2)16(20)11-14;/h5-6,11-12H,4,7-10H2,1-3H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | QZHGNCAQJHKQKE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|