C20H25F2IN4O — CID 111229306
3-fluoro-N-[2-[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methylbenzamide;hydroiodide (PubChem CID 111229306) has the molecular formula C20H25F2IN4O and a molecular weight of 502.35 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methylbenzamide;hydroiodide.
| Compound Name | 3-fluoro-N-[2-[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111229306 |
| Molecular Formula | C20H25F2IN4O |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 3-fluoro-N-[2-[[N-[2-(4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methylbenzamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(C)c(F)c1)NCCc1ccc(F)cc1.I |
| InChI | InChI=1S/C20H24F2N4O.HI/c1-14-3-6-16(13-18(14)22)19(27)24-11-12-26-20(23-2)25-10-9-15-4-7-17(21)8-5-15;/h3-8,13H,9-12H2,1-2H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | TWQXFEULESECBX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|