C22H25F2N5O — CID 111972084
3-fluoro-N-[2-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methylbenzamide (PubChem CID 111972084) has the molecular formula C22H25F2N5O and a molecular weight of 413.47 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methylbenzamide.
| Compound Name | 3-fluoro-N-[2-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 111972084 |
| Molecular Formula | C22H25F2N5O |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-fluoro-N-[2-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methylbenzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(C)c(F)c1)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C22H25F2N5O/c1-14-3-4-15(11-19(14)24)21(30)26-9-10-28-22(25-2)27-8-7-16-13-29-20-6-5-17(23)12-18(16)20/h3-6,11-13,29H,7-10H2,1-2H3,(H,26,30)(H2,25,27,28) |
| InChIKey | MPOIJFRFAZVWEA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|