C22H24FN5 — CID 111787771
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111787771) has the molecular formula C22H24FN5 and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111787771 |
| Molecular Formula | C22H24FN5 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1c[nH]c2ccccc12)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C22H24FN5/c1-24-22(25-10-8-15-13-27-20-5-3-2-4-18(15)20)26-11-9-16-14-28-21-7-6-17(23)12-19(16)21/h2-7,12-14,27-28H,8-11H2,1H3,(H2,24,25,26) |
| InChIKey | ZTSZGBUDIXOZOX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|