C20H21F3N4O — CID 111972092
1-[[2-(difluoromethoxy)phenyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111972092) has the molecular formula C20H21F3N4O and a molecular weight of 390.41 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111972092 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C20H21F3N4O/c1-24-20(27-12-14-4-2-3-5-18(14)28-19(22)23)25-9-8-13-11-26-17-7-6-15(21)10-16(13)17/h2-7,10-11,19,26H,8-9,12H2,1H3,(H2,24,25,27) |
| InChIKey | FKGWLZPALLDOTC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|