C20H23F2IN4 — CID 111788208
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111788208) has the molecular formula C20H23F2IN4 and a molecular weight of 484.33 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111788208 |
| Molecular Formula | C20H23F2IN4 |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C20H22F2N4.HI/c1-23-20(24-10-8-14-2-4-16(21)5-3-14)25-11-9-15-13-26-19-7-6-17(22)12-18(15)19;/h2-7,12-13,26H,8-11H2,1H3,(H2,23,24,25);1H |
| InChIKey | MBLXJKSTQFTFBM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|