C18H29FIN5 — CID 111972663
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111972663) has the molecular formula C18H29FIN5 and a molecular weight of 461.37 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111972663 |
| Molecular Formula | C18H29FIN5 |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-[methyl(propan-2-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCCN(C)C(C)C.I |
| InChI | InChI=1S/C18H28FN5.HI/c1-13(2)24(4)10-9-22-18(20-3)21-8-7-14-12-23-17-6-5-15(19)11-16(14)17;/h5-6,11-13,23H,7-10H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | HKRSZSVYTIVHAL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|