C23H30FN5O — CID 111973376
1-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111973376) has the molecular formula C23H30FN5O and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111973376 |
| Molecular Formula | C23H30FN5O |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCc1ccccc1OCCN(C)C |
| InChI | InChI=1S/C23H30FN5O/c1-25-23(26-11-10-17-15-27-21-9-8-19(24)14-20(17)21)28-16-18-6-4-5-7-22(18)30-13-12-29(2)3/h4-9,14-15,27H,10-13,16H2,1-3H3,(H2,25,26,28) |
| InChIKey | OSAVZDKJMGODGK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|