C17H24FN5O — CID 111972408
3-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide (PubChem CID 111972408) has the molecular formula C17H24FN5O and a molecular weight of 333.41 g/mol. Its IUPAC name is 3-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 111972408 |
| Molecular Formula | C17H24FN5O |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 3-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C17H24FN5O/c1-19-17(21-9-7-16(24)23(2)3)20-8-6-12-11-22-15-5-4-13(18)10-14(12)15/h4-5,10-11,22H,6-9H2,1-3H3,(H2,19,20,21) |
| InChIKey | SAFGKDBPUPWGHJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|