C21H24F2N4O2 — CID 110995407
1-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 110995407) has the molecular formula C21H24F2N4O2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110995407 |
| Molecular Formula | C21H24F2N4O2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C21H24F2N4O2/c1-24-21(25-10-9-15-13-26-17-6-4-3-5-16(15)17)27-12-14-7-8-18(28-2)19(11-14)29-20(22)23/h3-8,11,13,20,26H,9-10,12H2,1-2H3,(H2,24,25,27) |
| InChIKey | GKXLKRSBETXIQD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|