C22H26F3IN4O2 — CID 110995208
1-[2-(1H-indol-3-yl)ethyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 110995208) has the molecular formula C22H26F3IN4O2 and a molecular weight of 562.37 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110995208 |
| Molecular Formula | C22H26F3IN4O2 |
| Molecular Weight | 562.37 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1ccc(OCC(F)(F)F)c(OC)c1.I |
| InChI | InChI=1S/C22H25F3N4O2.HI/c1-26-21(27-10-9-16-13-28-18-6-4-3-5-17(16)18)29-12-15-7-8-19(20(11-15)30-2)31-14-22(23,24)25;/h3-8,11,13,28H,9-10,12,14H2,1-2H3,(H2,26,27,29);1H |
| InChIKey | IZENHOFIHOCNNE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|