C21H25FN4O2 — CID 111200658
1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111200658) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111200658 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H25FN4O2/c1-23-21(26-12-14-4-7-19(27-2)20(10-14)28-3)24-9-8-15-13-25-18-11-16(22)5-6-17(15)18/h4-7,10-11,13,25H,8-9,12H2,1-3H3,(H2,23,24,26) |
| InChIKey | UVORXIVJNWZTOA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|