C21H27FIN5O2S — CID 111887712
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111887712) has the molecular formula C21H27FIN5O2S and a molecular weight of 559.45 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111887712 |
| Molecular Formula | C21H27FIN5O2S |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCc1ccc(CS(=O)(=O)NC)cc1.I |
| InChI | InChI=1S/C21H26FN5O2S.HI/c1-23-21(25-10-9-17-13-26-20-11-18(22)7-8-19(17)20)27-12-15-3-5-16(6-4-15)14-30(28,29)24-2;/h3-8,11,13,24,26H,9-10,12,14H2,1-2H3,(H2,23,25,27);1H |
| InChIKey | PUUQEVIBEMFCFN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|