C23H29FIN5O — CID 111888364
3-[[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N-propylbenzamide;hydroiodide (PubChem CID 111888364) has the molecular formula C23H29FIN5O and a molecular weight of 537.42 g/mol. Its IUPAC name is 3-[[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N-propylbenzamide;hydroiodide.
| Compound Name | 3-[[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N-propylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111888364 |
| Molecular Formula | C23H29FIN5O |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 3-[[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N-propylbenzamide;hydroiodide |
| SMILES | CCCNC(=O)c1cccc(CN/C(=N\C)NCCc2c[nH]c3cc(F)ccc23)c1.I |
| InChI | InChI=1S/C23H28FN5O.HI/c1-3-10-26-22(30)17-6-4-5-16(12-17)14-29-23(25-2)27-11-9-18-15-28-21-13-19(24)7-8-20(18)21;/h4-8,12-13,15,28H,3,9-11,14H2,1-2H3,(H,26,30)(H2,25,27,29);1H |
| InChIKey | KBHJVDDLAPSNEQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|