C24H26FN7O — CID 111888861
N-[3-[[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide (PubChem CID 111888861) has the molecular formula C24H26FN7O and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[3-[[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[3-[[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 111888861 |
| Molecular Formula | C24H26FN7O |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-[3-[[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCc1cccc(NC(=O)Cn2cccn2)c1 |
| InChI | InChI=1S/C24H26FN7O/c1-26-24(27-10-8-18-15-28-22-13-19(25)6-7-21(18)22)29-14-17-4-2-5-20(12-17)31-23(33)16-32-11-3-9-30-32/h2-7,9,11-13,15,28H,8,10,14,16H2,1H3,(H,31,33)(H2,26,27,29) |
| InChIKey | CCIZACGSPOKZEI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|