C20H20FN5 — CID 111888761
1-[(3-cyanophenyl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111888761) has the molecular formula C20H20FN5 and a molecular weight of 349.41 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(3-cyanophenyl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111888761 |
| Molecular Formula | C20H20FN5 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCc1cccc(C#N)c1 |
| InChI | InChI=1S/C20H20FN5/c1-23-20(26-12-15-4-2-3-14(9-15)11-22)24-8-7-16-13-25-19-10-17(21)5-6-18(16)19/h2-6,9-10,13,25H,7-8,12H2,1H3,(H2,23,24,26) |
| InChIKey | SFHMBGAQZCPGTB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|