C25H26FN5O — CID 111888955
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine (PubChem CID 111888955) has the molecular formula C25H26FN5O and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111888955 |
| Molecular Formula | C25H26FN5O |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCc1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C25H26FN5O/c1-27-25(29-13-11-19-16-30-24-14-20(26)7-10-23(19)24)31-15-18-5-8-22(9-6-18)32-17-21-4-2-3-12-28-21/h2-10,12,14,16,30H,11,13,15,17H2,1H3,(H2,27,29,31) |
| InChIKey | SHNNEJUBAHPLFT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|