C19H22FN5 — CID 110971241
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 110971241) has the molecular formula C19H22FN5 and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110971241 |
| Molecular Formula | C19H22FN5 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C19H22FN5/c1-2-21-19(25-13-16-5-3-4-9-22-16)23-10-8-14-12-24-18-11-15(20)6-7-17(14)18/h3-7,9,11-12,24H,2,8,10,13H2,1H3,(H2,21,23,25) |
| InChIKey | SPQUBVRWTSMWOR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|