C17H20F2N4 — CID 111965389
1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 111965389) has the molecular formula C17H20F2N4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111965389 |
| Molecular Formula | C17H20F2N4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCc1cc(F)ccc1F |
| InChI | InChI=1S/C17H20F2N4/c1-2-20-17(23-12-15-5-3-4-9-21-15)22-10-8-13-11-14(18)6-7-16(13)19/h3-7,9,11H,2,8,10,12H2,1H3,(H2,20,22,23) |
| InChIKey | JWUVUHCQMAVKMV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|