C18H24FIN4 — CID 111191443
1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111191443) has the molecular formula C18H24FIN4 and a molecular weight of 442.32 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111191443 |
| Molecular Formula | C18H24FIN4 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)c(F)c1)NCCc1ccccn1.I |
| InChI | InChI=1S/C18H23FN4.HI/c1-3-20-18(22-11-9-16-6-4-5-10-21-16)23-13-15-8-7-14(2)17(19)12-15;/h4-8,10,12H,3,9,11,13H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | FUYCLSNEJYBJDS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|