C17H21BrFIN4 — CID 111193947
2-[(3-bromo-5-fluorophenyl)methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111193947) has the molecular formula C17H21BrFIN4 and a molecular weight of 507.19 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorophenyl)methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(3-bromo-5-fluorophenyl)methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111193947 |
| Molecular Formula | C17H21BrFIN4 |
| Molecular Weight | 507.19 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | 2-[(3-bromo-5-fluorophenyl)methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)cc(Br)c1)NCCc1ccccn1.I |
| InChI | InChI=1S/C17H20BrFN4.HI/c1-2-20-17(22-8-6-16-5-3-4-7-21-16)23-12-13-9-14(18)11-15(19)10-13;/h3-5,7,9-11H,2,6,8,12H2,1H3,(H2,20,22,23);1H |
| InChIKey | JFJWPESZDKMIPE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|