C19H25BrFIN4 — CID 111604024
2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111604024) has the molecular formula C19H25BrFIN4 and a molecular weight of 535.24 g/mol. Its IUPAC name is 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111604024 |
| Molecular Formula | C19H25BrFIN4 |
| Molecular Weight | 535.24 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1ccc(Br)cc1F)NCCc1ccccn1.I |
| InChI | InChI=1S/C19H24BrFN4.HI/c1-2-22-19(25-13-10-17-7-3-4-11-23-17)24-12-5-6-15-8-9-16(20)14-18(15)21;/h3-4,7-9,11,14H,2,5-6,10,12-13H2,1H3,(H2,22,24,25);1H |
| InChIKey | JTEHOLGRMQQBAL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|