C14H22BrFN4O2S — CID 111604112
2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine (PubChem CID 111604112) has the molecular formula C14H22BrFN4O2S and a molecular weight of 409.33 g/mol. Its IUPAC name is 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine.
| Compound Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111604112 |
| Molecular Formula | C14H22BrFN4O2S |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine |
| SMILES | CCN/C(=N\CCCc1ccc(Br)cc1F)NCCS(N)(=O)=O |
| InChI | InChI=1S/C14H22BrFN4O2S/c1-2-18-14(20-8-9-23(17,21)22)19-7-3-4-11-5-6-12(15)10-13(11)16/h5-6,10H,2-4,7-9H2,1H3,(H2,17,21,22)(H2,18,19,20) |
| InChIKey | BFVQDJVBNRPZQW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|