C21H26BrFN4O — CID 111604055
3-[[[[3-(4-bromo-2-fluorophenyl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide (PubChem CID 111604055) has the molecular formula C21H26BrFN4O and a molecular weight of 449.37 g/mol. Its IUPAC name is 3-[[[[3-(4-bromo-2-fluorophenyl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[[[3-(4-bromo-2-fluorophenyl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111604055 |
| Molecular Formula | C21H26BrFN4O |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 3-[[[[3-(4-bromo-2-fluorophenyl)propylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC)c1)NCCCc1ccc(Br)cc1F |
| InChI | InChI=1S/C21H26BrFN4O/c1-3-25-21(26-11-5-8-16-9-10-18(22)13-19(16)23)27-14-15-6-4-7-17(12-15)20(28)24-2/h4,6-7,9-10,12-13H,3,5,8,11,14H2,1-2H3,(H,24,28)(H2,25,26,27) |
| InChIKey | UDDMCLPWTCZRDF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|