C18H24BrIN4OS — CID 111632089
3-[2-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111632089) has the molecular formula C18H24BrIN4OS and a molecular weight of 551.29 g/mol. Its IUPAC name is 3-[2-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111632089 |
| Molecular Formula | C18H24BrIN4OS |
| Molecular Weight | 551.29 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | 3-[2-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)cs1)NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C18H23BrN4OS.HI/c1-3-21-18(23-11-16-10-15(19)12-25-16)22-8-7-13-5-4-6-14(9-13)17(24)20-2;/h4-6,9-10,12H,3,7-8,11H2,1-2H3,(H,20,24)(H2,21,22,23);1H |
| InChIKey | LOHJRWOCPKZLEU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|