C25H35N5O2 — CID 111631728
3-[2-[[N'-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111631728) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 3-[2-[[N'-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N'-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111631728 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 3-[2-[[N'-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)NCCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C25H35N5O2/c1-5-18(3)30-24(32)22-12-8-10-20(16-22)17-29-25(27-6-2)28-14-13-19-9-7-11-21(15-19)23(31)26-4/h7-12,15-16,18H,5-6,13-14,17H2,1-4H3,(H,26,31)(H,30,32)(H2,27,28,29) |
| InChIKey | PVZMCRCZUOXYFY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|