C25H37IN4O3 — CID 111214098
N-butan-2-yl-3-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111214098) has the molecular formula C25H37IN4O3 and a molecular weight of 568.50 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111214098 |
| Molecular Formula | C25H37IN4O3 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | N-butan-2-yl-3-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)NCCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C25H36N4O3.HI/c1-6-18(3)29-24(30)21-10-8-9-20(15-21)17-28-25(26-7-2)27-14-13-19-11-12-22(31-4)23(16-19)32-5;/h8-12,15-16,18H,6-7,13-14,17H2,1-5H3,(H,29,30)(H2,26,27,28);1H |
| InChIKey | IPQVGCNHPMSXGB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|