C24H35IN4O2 — CID 111169215
N-butan-2-yl-3-[[[ethylamino-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111169215) has the molecular formula C24H35IN4O2 and a molecular weight of 538.47 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[ethylamino-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[[ethylamino-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111169215 |
| Molecular Formula | C24H35IN4O2 |
| Molecular Weight | 538.47 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | N-butan-2-yl-3-[[[ethylamino-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)NCCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C24H34N4O2.HI/c1-5-18(3)28-23(29)21-9-7-8-20(16-21)17-27-24(25-6-2)26-15-14-19-10-12-22(30-4)13-11-19;/h7-13,16,18H,5-6,14-15,17H2,1-4H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | CVRWUDPTPTUDEJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|