C23H31FN4O — CID 111362035
N-butan-2-yl-3-[[[ethylamino-[2-(2-fluorophenyl)ethylamino]methylidene]amino]methyl]benzamide (PubChem CID 111362035) has the molecular formula C23H31FN4O and a molecular weight of 398.53 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[ethylamino-[2-(2-fluorophenyl)ethylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[[ethylamino-[2-(2-fluorophenyl)ethylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111362035 |
| Molecular Formula | C23H31FN4O |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | N-butan-2-yl-3-[[[ethylamino-[2-(2-fluorophenyl)ethylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)NCCc1ccccc1F |
| InChI | InChI=1S/C23H31FN4O/c1-4-17(3)28-22(29)20-11-8-9-18(15-20)16-27-23(25-5-2)26-14-13-19-10-6-7-12-21(19)24/h6-12,15,17H,4-5,13-14,16H2,1-3H3,(H,28,29)(H2,25,26,27) |
| InChIKey | JAWAHLHCBHPNMD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|