C23H32N4O — CID 110948290
N-butan-2-yl-3-[[[ethylamino-(1-phenylethylamino)methylidene]amino]methyl]benzamide (PubChem CID 110948290) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[ethylamino-(1-phenylethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[[ethylamino-(1-phenylethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 110948290 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | N-butan-2-yl-3-[[[ethylamino-(1-phenylethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)CC)c1)NC(C)c1ccccc1 |
| InChI | InChI=1S/C23H32N4O/c1-5-17(3)26-22(28)21-14-10-11-19(15-21)16-25-23(24-6-2)27-18(4)20-12-8-7-9-13-20/h7-15,17-18H,5-6,16H2,1-4H3,(H,26,28)(H2,24,25,27) |
| InChIKey | DYYILGBQJYBZPU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|