C23H32FIN4O — CID 111395490
N-butan-2-yl-4-[[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111395490) has the molecular formula C23H32FIN4O and a molecular weight of 526.44 g/mol. Its IUPAC name is N-butan-2-yl-4-[[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-4-[[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111395490 |
| Molecular Formula | C23H32FIN4O |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | N-butan-2-yl-4-[[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC(C)CC)cc1)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C23H31FN4O.HI/c1-4-17(3)28-22(29)20-11-9-19(10-12-20)16-27-23(25-5-2)26-14-13-18-7-6-8-21(24)15-18;/h6-12,15,17H,4-5,13-14,16H2,1-3H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | ZLHRSOWOLFPXDS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|