C17H27FN4O — CID 111876043
N-butan-2-yl-3-[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111876043) has the molecular formula C17H27FN4O and a molecular weight of 322.43 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111876043 |
| Molecular Formula | C17H27FN4O |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | N-butan-2-yl-3-[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCCC(=O)NC(C)CC |
| InChI | InChI=1S/C17H27FN4O/c1-4-13(3)22-16(23)9-10-20-17(19-5-2)21-12-14-7-6-8-15(18)11-14/h6-8,11,13H,4-5,9-10,12H2,1-3H3,(H,22,23)(H2,19,20,21) |
| InChIKey | OHFMKXSVVYYQTF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|