C22H34IN5OS — CID 111531240
N-butan-2-yl-4-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111531240) has the molecular formula C22H34IN5OS and a molecular weight of 543.52 g/mol. Its IUPAC name is N-butan-2-yl-4-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-4-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111531240 |
| Molecular Formula | C22H34IN5OS |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | N-butan-2-yl-4-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC(C)CC)cc1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C22H33N5OS.HI/c1-5-16(4)27-21(28)18-10-8-17(9-11-18)14-26-22(23-7-3)24-13-12-20-25-15-19(6-2)29-20;/h8-11,15-16H,5-7,12-14H2,1-4H3,(H,27,28)(H2,23,24,26);1H |
| InChIKey | DABCFJGAJHNNMO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|