C19H30IN5O2S2 — CID 111531604
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111531604) has the molecular formula C19H30IN5O2S2 and a molecular weight of 551.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111531604 |
| Molecular Formula | C19H30IN5O2S2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CS(=O)(=O)NC)cc1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C19H29N5O2S2.HI/c1-4-17-13-23-18(27-17)10-11-22-19(21-5-2)24-12-15-6-8-16(9-7-15)14-28(25,26)20-3;/h6-9,13,20H,4-5,10-12,14H2,1-3H3,(H2,21,22,24);1H |
| InChIKey | HXGQTIOQMGGAHX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|