C19H27N5O2S — CID 111532347
methyl N-[4-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]phenyl]carbamate (PubChem CID 111532347) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is methyl N-[4-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 111532347 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | methyl N-[4-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]phenyl]carbamate |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)OC)cc1)NCCc1ncc(CC)s1 |
| InChI | InChI=1S/C19H27N5O2S/c1-4-16-13-22-17(27-16)10-11-21-18(20-5-2)23-12-14-6-8-15(9-7-14)24-19(25)26-3/h6-9,13H,4-5,10-12H2,1-3H3,(H,24,25)(H2,20,21,23) |
| InChIKey | WBXWAVSUQGBSRR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|