C22H33N5OS — CID 111533551
N-[3-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide (PubChem CID 111533551) has the molecular formula C22H33N5OS and a molecular weight of 415.61 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide.
| Compound Name | N-[3-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 111533551 |
| Molecular Formula | C22H33N5OS |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | N-[3-[[[ethylamino-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]methyl]phenyl]-2-methylbutanamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C(C)CC)c1)NCCc1ncc(CC)s1 |
| InChI | InChI=1S/C22H33N5OS/c1-5-16(4)21(28)27-18-10-8-9-17(13-18)14-26-22(23-7-3)24-12-11-20-25-15-19(6-2)29-20/h8-10,13,15-16H,5-7,11-12,14H2,1-4H3,(H,27,28)(H2,23,24,26) |
| InChIKey | LKHIYFDNQFVTEX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|