C20H30IN5O2S2 — CID 111531242
2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111531242) has the molecular formula C20H30IN5O2S2 and a molecular weight of 563.53 g/mol. Its IUPAC name is 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111531242 |
| Molecular Formula | C20H30IN5O2S2 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)NC2CC2)cc1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C20H29N5O2S2.HI/c1-3-17-14-23-19(28-17)11-12-22-20(21-4-2)24-13-15-5-9-18(10-6-15)29(26,27)25-16-7-8-16;/h5-6,9-10,14,16,25H,3-4,7-8,11-13H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | RLLZUBCGVVBPAQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|