C20H28IN5O2S — CID 111192043
2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111192043) has the molecular formula C20H28IN5O2S and a molecular weight of 529.45 g/mol. Its IUPAC name is 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111192043 |
| Molecular Formula | C20H28IN5O2S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)NC2CC2)cc1)NCCc1ccccn1.I |
| InChI | InChI=1S/C20H27N5O2S.HI/c1-2-21-20(23-14-12-17-5-3-4-13-22-17)24-15-16-6-10-19(11-7-16)28(26,27)25-18-8-9-18;/h3-7,10-11,13,18,25H,2,8-9,12,14-15H2,1H3,(H2,21,23,24);1H |
| InChIKey | WDQKULVVEASJGZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|