C20H35IN4O3S — CID 111239262
1-(3-butoxypropyl)-2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111239262) has the molecular formula C20H35IN4O3S and a molecular weight of 538.50 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-(3-butoxypropyl)-2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111239262 |
| Molecular Formula | C20H35IN4O3S |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 1-(3-butoxypropyl)-2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCCCOCCCN/C(=N/Cc1ccc(S(=O)(=O)NC2CC2)cc1)NCC.I |
| InChI | InChI=1S/C20H34N4O3S.HI/c1-3-5-14-27-15-6-13-22-20(21-4-2)23-16-17-7-11-19(12-8-17)28(25,26)24-18-9-10-18;/h7-8,11-12,18,24H,3-6,9-10,13-16H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | KGAGRBKKGXLAPF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|