C23H33IN4O2S — CID 111621643
2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(4-methylphenyl)propyl]guanidine;hydroiodide (PubChem CID 111621643) has the molecular formula C23H33IN4O2S and a molecular weight of 556.51 g/mol. Its IUPAC name is 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(4-methylphenyl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(4-methylphenyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111621643 |
| Molecular Formula | C23H33IN4O2S |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(4-methylphenyl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)NC2CC2)cc1)NCC(C)c1ccc(C)cc1.I |
| InChI | InChI=1S/C23H32N4O2S.HI/c1-4-24-23(25-15-18(3)20-9-5-17(2)6-10-20)26-16-19-7-13-22(14-8-19)30(28,29)27-21-11-12-21;/h5-10,13-14,18,21,27H,4,11-12,15-16H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | DBVYKULZJAIWHY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|