C21H30N4O2S2 — CID 111673420
2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine (PubChem CID 111673420) has the molecular formula C21H30N4O2S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine.
| Compound Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111673420 |
| Molecular Formula | C21H30N4O2S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)NC2CC2)cc1)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C21H30N4O2S2/c1-3-22-21(23-14-16(2)13-19-5-4-12-28-19)24-15-17-6-10-20(11-7-17)29(26,27)25-18-8-9-18/h4-7,10-12,16,18,25H,3,8-9,13-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | YONNDPNTTMELCR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|