C21H31IN4OS — CID 111673409
4-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111673409) has the molecular formula C21H31IN4OS and a molecular weight of 514.48 g/mol. Its IUPAC name is 4-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111673409 |
| Molecular Formula | C21H31IN4OS |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 4-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCC(C)Cc1cccs1.I |
| InChI | InChI=1S/C21H30N4OS.HI/c1-5-22-21(23-14-16(2)13-19-7-6-12-27-19)24-15-17-8-10-18(11-9-17)20(26)25(3)4;/h6-12,16H,5,13-15H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | CKLCLXDTBYUUCN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|