C20H30IN3OS — CID 111674225
1-ethyl-2-[[2-(methoxymethyl)phenyl]methyl]-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111674225) has the molecular formula C20H30IN3OS and a molecular weight of 487.45 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(methoxymethyl)phenyl]methyl]-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(methoxymethyl)phenyl]methyl]-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111674225 |
| Molecular Formula | C20H30IN3OS |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 1-ethyl-2-[[2-(methoxymethyl)phenyl]methyl]-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1COC)NCC(C)Cc1cccs1.I |
| InChI | InChI=1S/C20H29N3OS.HI/c1-4-21-20(22-13-16(2)12-19-10-7-11-25-19)23-14-17-8-5-6-9-18(17)15-24-3;/h5-11,16H,4,12-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | FIIFGSHHSWBSTK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|