C20H33N5OS — CID 111673470
1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine (PubChem CID 111673470) has the molecular formula C20H33N5OS and a molecular weight of 391.59 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111673470 |
| Molecular Formula | C20H33N5OS |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C20H33N5OS/c1-6-21-20(22-13-15(2)12-18-8-7-11-27-18)23-14-19-16(3)24-25(17(19)4)9-10-26-5/h7-8,11,15H,6,9-10,12-14H2,1-5H3,(H2,21,22,23) |
| InChIKey | GMKCLQUKYSYKGT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|